C22H19Br2NO2 — CID 175762133
3,5-dibromo-2-[(4-methoxyphenyl)methyl]-1-phenyl-6,7-dihydro-5H-isoindol-4-one (PubChem CID 175762133) has the molecular formula C22H19Br2NO2 and a molecular weight of 489.21 g/mol. Its IUPAC name is 3,5-dibromo-2-[(4-methoxyphenyl)methyl]-1-phenyl-6,7-dihydro-5H-isoindol-4-one.
| Compound Name | 3,5-dibromo-2-[(4-methoxyphenyl)methyl]-1-phenyl-6,7-dihydro-5H-isoindol-4-one |
|---|---|
| PubChem CID | 175762133 |
| Molecular Formula | C22H19Br2NO2 |
| Molecular Weight | 489.21 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | 3,5-dibromo-2-[(4-methoxyphenyl)methyl]-1-phenyl-6,7-dihydro-5H-isoindol-4-one |
| SMILES | COc1ccc(Cn2c(Br)c3c(c2-c2ccccc2)CCC(Br)C3=O)cc1 |
| InChI | InChI=1S/C22H19Br2NO2/c1-27-16-9-7-14(8-10-16)13-25-20(15-5-3-2-4-6-15)17-11-12-18(23)21(26)19(17)22(25)24/h2-10,18H,11-13H2,1H3 |
| InChIKey | BUGJYHRPZUWCKQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.21 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|