C19H21F3N2O — CID 175762694
2-methyl-1-[2-[prop-2-ynyl-[[3-(trifluoromethyl)phenyl]methyl]amino]ethyl]-2H-pyridin-3-ol (PubChem CID 175762694) has the molecular formula C19H21F3N2O and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-methyl-1-[2-[prop-2-ynyl-[[3-(trifluoromethyl)phenyl]methyl]amino]ethyl]-2H-pyridin-3-ol.
| Compound Name | 2-methyl-1-[2-[prop-2-ynyl-[[3-(trifluoromethyl)phenyl]methyl]amino]ethyl]-2H-pyridin-3-ol |
|---|---|
| PubChem CID | 175762694 |
| Molecular Formula | C19H21F3N2O |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-methyl-1-[2-[prop-2-ynyl-[[3-(trifluoromethyl)phenyl]methyl]amino]ethyl]-2H-pyridin-3-ol |
| SMILES | C#CCN(CCN1C=CC=C(O)C1C)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N2O/c1-3-9-23(11-12-24-10-5-8-18(25)15(24)2)14-16-6-4-7-17(13-16)19(20,21)22/h1,4-8,10,13,15,25H,9,11-12,14H2,2H3 |
| InChIKey | ODAPWBUHUVSWHM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|