C14H20Cl2N2O4S — CID 175764569
4,5-dichloro-2-[[1-(2-methoxyethylsulfonyl)piperidin-4-yl]amino]phenol (PubChem CID 175764569) has the molecular formula C14H20Cl2N2O4S and a molecular weight of 383.30 g/mol. Its IUPAC name is 4,5-dichloro-2-[[1-(2-methoxyethylsulfonyl)piperidin-4-yl]amino]phenol.
| Compound Name | 4,5-dichloro-2-[[1-(2-methoxyethylsulfonyl)piperidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 175764569 |
| Molecular Formula | C14H20Cl2N2O4S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 4,5-dichloro-2-[[1-(2-methoxyethylsulfonyl)piperidin-4-yl]amino]phenol |
| SMILES | COCCS(=O)(=O)N1CCC(Nc2cc(Cl)c(Cl)cc2O)CC1 |
| InChI | InChI=1S/C14H20Cl2N2O4S/c1-22-6-7-23(20,21)18-4-2-10(3-5-18)17-13-8-11(15)12(16)9-14(13)19/h8-10,17,19H,2-7H2,1H3 |
| InChIKey | BXOCKFITLRROMW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|