C14H23ClN4O4S — CID 75537864
4-chloro-1-ethyl-N-[1-(2-methoxyethylsulfonyl)piperidin-4-yl]pyrazole-3-carboxamide (PubChem CID 75537864) has the molecular formula C14H23ClN4O4S and a molecular weight of 378.88 g/mol. Its IUPAC name is 4-chloro-1-ethyl-N-[1-(2-methoxyethylsulfonyl)piperidin-4-yl]pyrazole-3-carboxamide.
| Compound Name | 4-chloro-1-ethyl-N-[1-(2-methoxyethylsulfonyl)piperidin-4-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 75537864 |
| Molecular Formula | C14H23ClN4O4S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 4-chloro-1-ethyl-N-[1-(2-methoxyethylsulfonyl)piperidin-4-yl]pyrazole-3-carboxamide |
| SMILES | CCn1cc(Cl)c(C(=O)NC2CCN(S(=O)(=O)CCOC)CC2)n1 |
| InChI | InChI=1S/C14H23ClN4O4S/c1-3-18-10-12(15)13(17-18)14(20)16-11-4-6-19(7-5-11)24(21,22)9-8-23-2/h10-11H,3-9H2,1-2H3,(H,16,20) |
| InChIKey | JAZROFUBVKYLIX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |