C19H31N3O6S — CID 55722013
2-methoxyethyl 2,4-dimethyl-5-[(1-propylsulfonylpiperidin-4-yl)carbamoyl]-1H-pyrrole-3-carboxylate (PubChem CID 55722013) has the molecular formula C19H31N3O6S and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-methoxyethyl 2,4-dimethyl-5-[(1-propylsulfonylpiperidin-4-yl)carbamoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | 2-methoxyethyl 2,4-dimethyl-5-[(1-propylsulfonylpiperidin-4-yl)carbamoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55722013 |
| Molecular Formula | C19H31N3O6S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-methoxyethyl 2,4-dimethyl-5-[(1-propylsulfonylpiperidin-4-yl)carbamoyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCCS(=O)(=O)N1CCC(NC(=O)c2[nH]c(C)c(C(=O)OCCOC)c2C)CC1 |
| InChI | InChI=1S/C19H31N3O6S/c1-5-12-29(25,26)22-8-6-15(7-9-22)21-18(23)17-13(2)16(14(3)20-17)19(24)28-11-10-27-4/h15,20H,5-12H2,1-4H3,(H,21,23) |
| InChIKey | MYPBJGMCHGWGTA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|