C30H39NO5 — CID 175765546
[(3S,8S,9S,10R,13S,14S)-13-[2-[(3-methoxybenzoyl)amino]ethyl]-10-methyl-16-oxo-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 175765546) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S)-13-[2-[(3-methoxybenzoyl)amino]ethyl]-10-methyl-16-oxo-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13S,14S)-13-[2-[(3-methoxybenzoyl)amino]ethyl]-10-methyl-16-oxo-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 175765546 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S)-13-[2-[(3-methoxybenzoyl)amino]ethyl]-10-methyl-16-oxo-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | COc1cccc(C(=O)NCC[C@]23CC[C@H]4[C@@H](CC=C5C[C@@H](OC(C)=O)CC[C@@]54C)[C@@H]2CC(=O)C3)c1 |
| InChI | InChI=1S/C30H39NO5/c1-19(32)36-24-9-11-29(2)21(16-24)7-8-25-26(29)10-12-30(18-22(33)17-27(25)30)13-14-31-28(34)20-5-4-6-23(15-20)35-3/h4-7,15,24-27H,8-14,16-18H2,1-3H3,(H,31,34)/t24-,25+,26-,27-,29-,30-/m0/s1 |
| InChIKey | SYEMKYAGCBDPRQ-GPPMMCNHSA-N |
| XLogP | 5.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|