C28H37N3O3 — CID 175766908
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(6-butoxy-3-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate (PubChem CID 175766908) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(6-butoxy-3-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(6-butoxy-3-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate |
|---|---|
| PubChem CID | 175766908 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(6-butoxy-3-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate |
| SMILES | CCCCOc1ccc(-c2ccc3c(c2)CC(C)(C)C3NC(=O)O[C@H]2CN3CCC2CC3)cn1 |
| InChI | InChI=1S/C28H37N3O3/c1-4-5-14-33-25-9-7-21(17-29-25)20-6-8-23-22(15-20)16-28(2,3)26(23)30-27(32)34-24-18-31-12-10-19(24)11-13-31/h6-9,15,17,19,24,26H,4-5,10-14,16,18H2,1-3H3,(H,30,32)/t24-,26?/m0/s1 |
| InChIKey | ZTSKLDRZYHVONE-QSAPEBAKSA-N |
| XLogP | 5.37 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|