C31H42N2O4 — CID 175822239
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[(1R)-5-(4-butoxyphenyl)-6-ethoxy-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate (PubChem CID 175822239) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[(1R)-5-(4-butoxyphenyl)-6-ethoxy-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[(1R)-5-(4-butoxyphenyl)-6-ethoxy-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate |
|---|---|
| PubChem CID | 175822239 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[(1R)-5-(4-butoxyphenyl)-6-ethoxy-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate |
| SMILES | CCCCOc1ccc(-c2cc3c(cc2OCC)[C@H](NC(=O)O[C@H]2CN4CCC2CC4)C(C)(C)C3)cc1 |
| InChI | InChI=1S/C31H42N2O4/c1-5-7-16-36-24-10-8-21(9-11-24)25-17-23-19-31(3,4)29(26(23)18-27(25)35-6-2)32-30(34)37-28-20-33-14-12-22(28)13-15-33/h8-11,17-18,22,28-29H,5-7,12-16,19-20H2,1-4H3,(H,32,34)/t28-,29-/m0/s1 |
| InChIKey | VFWZTRWRFUTXSY-VMPREFPWSA-N |
| XLogP | 6.38 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|