C17H17NO — CID 175772707
7-tert-butyl-2-phenyl-1,3-benzoxazole (PubChem CID 175772707) has the molecular formula C17H17NO and a molecular weight of 252.32 g/mol. Its IUPAC name is 7-tert-butyl-2-phenyl-1,3-benzoxazole.
| Compound Name | 7-tert-butyl-2-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 175772707 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 7-tert-butyl-2-phenyl-1,3-benzoxazole |
| SMILES | CC(C)(C)c1cccc2n[13c](-c3ccccc3)oc12 |
| InChI | InChI=1S/C17H17NO/c1-17(2,3)13-10-7-11-14-15(13)19-16(18-14)12-8-5-4-6-9-12/h4-11H,1-3H3/i16+1 |
| InChIKey | MVPNGQWCFYGJSO-LOYIAQTISA-N |
| XLogP | 4.79 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |