C21H15NO2 — CID 145303189
5-methyl-2-(2-phenyl-1,3-benzoxazol-7-yl)benzaldehyde (PubChem CID 145303189) has the molecular formula C21H15NO2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 5-methyl-2-(2-phenyl-1,3-benzoxazol-7-yl)benzaldehyde.
| Compound Name | 5-methyl-2-(2-phenyl-1,3-benzoxazol-7-yl)benzaldehyde |
|---|---|
| PubChem CID | 145303189 |
| Molecular Formula | C21H15NO2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 5-methyl-2-(2-phenyl-1,3-benzoxazol-7-yl)benzaldehyde |
| SMILES | Cc1ccc(-c2cccc3nc(-c4ccccc4)oc23)c(C=O)c1 |
| InChI | InChI=1S/C21H15NO2/c1-14-10-11-17(16(12-14)13-23)18-8-5-9-19-20(18)24-21(22-19)15-6-3-2-4-7-15/h2-13H,1H3 |
| InChIKey | KJBLUCQAUZTPIN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|