C13H19NO2 — CID 175773840
N-hydroxy-2,2,3-trimethyl-4-phenylbutanamide (PubChem CID 175773840) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-hydroxy-2,2,3-trimethyl-4-phenylbutanamide.
| Compound Name | N-hydroxy-2,2,3-trimethyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 175773840 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-hydroxy-2,2,3-trimethyl-4-phenylbutanamide |
| SMILES | CC(Cc1ccccc1)C(C)(C)C(=O)NO |
| InChI | InChI=1S/C13H19NO2/c1-10(13(2,3)12(15)14-16)9-11-7-5-4-6-8-11/h4-8,10,16H,9H2,1-3H3,(H,14,15) |
| InChIKey | PKLKFKBQISFRSA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|