C21H23N — CID 175775241
1'-benzyl-5-methylspiro[indene-2,4'-piperidine] (PubChem CID 175775241) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 1'-benzyl-5-methylspiro[indene-2,4'-piperidine].
| Compound Name | 1'-benzyl-5-methylspiro[indene-2,4'-piperidine] |
|---|---|
| PubChem CID | 175775241 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1'-benzyl-5-methylspiro[indene-2,4'-piperidine] |
| SMILES | Cc1ccc2c(c1)=CC1(C=2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N/c1-17-7-8-19-14-21(15-20(19)13-17)9-11-22(12-10-21)16-18-5-3-2-4-6-18/h2-8,13-15H,9-12,16H2,1H3 |
| InChIKey | HKEYQFHBSQEEKA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |