C8H13NO6 — CID 175776625
5-[carboxymethyl(hydroxy)amino]-3-methyl-5-oxopentanoic acid (PubChem CID 175776625) has the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. Its IUPAC name is 5-[carboxymethyl(hydroxy)amino]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[carboxymethyl(hydroxy)amino]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175776625 |
| Molecular Formula | C8H13NO6 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 5-[carboxymethyl(hydroxy)amino]-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)N(O)CC(=O)O |
| InChI | InChI=1S/C8H13NO6/c1-5(3-7(11)12)2-6(10)9(15)4-8(13)14/h5,15H,2-4H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | UBKRPQHFSWFAFQ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|