C26H29ClN6O — CID 175777557
3-chloro-2-[(3,4-dimethylphenyl)methyl]-7-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]-3H-pyrrolo[3,4-c]pyridin-1-one (PubChem CID 175777557) has the molecular formula C26H29ClN6O and a molecular weight of 477.01 g/mol. Its IUPAC name is 3-chloro-2-[(3,4-dimethylphenyl)methyl]-7-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]-3H-pyrrolo[3,4-c]pyridin-1-one.
| Compound Name | 3-chloro-2-[(3,4-dimethylphenyl)methyl]-7-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]-3H-pyrrolo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 175777557 |
| Molecular Formula | C26H29ClN6O |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 3-chloro-2-[(3,4-dimethylphenyl)methyl]-7-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]-3H-pyrrolo[3,4-c]pyridin-1-one |
| SMILES | Cc1ccc(CN2C(=O)c3c(Nc4ccc(N5CCN(C)CC5)cn4)cncc3C2Cl)cc1C |
| InChI | InChI=1S/C26H29ClN6O/c1-17-4-5-19(12-18(17)2)16-33-25(27)21-14-28-15-22(24(21)26(33)34)30-23-7-6-20(13-29-23)32-10-8-31(3)9-11-32/h4-7,12-15,25H,8-11,16H2,1-3H3,(H,29,30) |
| InChIKey | VNHZDYBWHCXBLD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|