C17H30O4Si — CID 175778772
tert-butyl [3-(2-trimethylsilylethoxymethyl)cyclohexa-1,5-dien-1-yl] carbonate (PubChem CID 175778772) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is tert-butyl [3-(2-trimethylsilylethoxymethyl)cyclohexa-1,5-dien-1-yl] carbonate.
| Compound Name | tert-butyl [3-(2-trimethylsilylethoxymethyl)cyclohexa-1,5-dien-1-yl] carbonate |
|---|---|
| PubChem CID | 175778772 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | tert-butyl [3-(2-trimethylsilylethoxymethyl)cyclohexa-1,5-dien-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)OC1=CC(COCC[Si](C)(C)C)CC=C1 |
| InChI | InChI=1S/C17H30O4Si/c1-17(2,3)21-16(18)20-15-9-7-8-14(12-15)13-19-10-11-22(4,5)6/h7,9,12,14H,8,10-11,13H2,1-6H3 |
| InChIKey | XPDWKTICQUJRFN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|