C17H30O4Si — CID 134813865
[(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4,8-trienyl] methyl carbonate (PubChem CID 134813865) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4,8-trienyl] methyl carbonate.
| Compound Name | [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4,8-trienyl] methyl carbonate |
|---|---|
| PubChem CID | 134813865 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [(2E,4Z)-4-[tert-butyl(dimethyl)silyl]oxynona-2,4,8-trienyl] methyl carbonate |
| SMILES | C=CCC/C=C(/C=C/COC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O4Si/c1-8-9-10-12-15(13-11-14-20-16(18)19-5)21-22(6,7)17(2,3)4/h8,11-13H,1,9-10,14H2,2-7H3/b13-11+,15-12- |
| InChIKey | HLCNOKSNDLITIF-DZIWGARNSA-N |
| XLogP | 5.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|