C20H38O5Si — CID 158929573
tert-butyl-[(2R,5R,6E,8Z)-5-(methoxymethoxy)undeca-6,8-dien-2-yl]oxy-dimethylsilane;carbon dioxide (PubChem CID 158929573) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is tert-butyl-[(2R,5R,6E,8Z)-5-(methoxymethoxy)undeca-6,8-dien-2-yl]oxy-dimethylsilane;carbon dioxide.
| Compound Name | tert-butyl-[(2R,5R,6E,8Z)-5-(methoxymethoxy)undeca-6,8-dien-2-yl]oxy-dimethylsilane;carbon dioxide |
|---|---|
| PubChem CID | 158929573 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | tert-butyl-[(2R,5R,6E,8Z)-5-(methoxymethoxy)undeca-6,8-dien-2-yl]oxy-dimethylsilane;carbon dioxide |
| SMILES | CC/C=C\C=C\[C@@H](CC[C@@H](C)O[Si](C)(C)C(C)(C)C)OCOC.O=C=O |
| InChI | InChI=1S/C19H38O3Si.CO2/c1-9-10-11-12-13-18(21-16-20-6)15-14-17(2)22-23(7,8)19(3,4)5;2-1-3/h10-13,17-18H,9,14-16H2,1-8H3;/b11-10-,13-12+;/t17-,18+;/m1./s1 |
| InChIKey | JIWLZPPKASXPRQ-CHYLEQMUSA-N |
| XLogP | 5.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|