C18H34O4Si — CID 25112093
ethyl [(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl] carbonate (PubChem CID 25112093) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is ethyl [(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl] carbonate.
| Compound Name | ethyl [(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl] carbonate |
|---|---|
| PubChem CID | 25112093 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | ethyl [(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl] carbonate |
| SMILES | CCOC(=O)O[C@H]1C=C[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C18H34O4Si/c1-8-20-18(19)22-17-10-9-16(11-17)12-21-23(13(2)3,14(4)5)15(6)7/h9-10,13-17H,8,11-12H2,1-7H3/t16-,17+/m1/s1 |
| InChIKey | PSQFLDYAGDYBMN-SJORKVTESA-N |
| XLogP | 5.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|