C13H24O4Si — CID 134813783
[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienyl] methyl carbonate (PubChem CID 134813783) has the molecular formula C13H24O4Si and a molecular weight of 272.42 g/mol. Its IUPAC name is [(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienyl] methyl carbonate.
| Compound Name | [(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienyl] methyl carbonate |
|---|---|
| PubChem CID | 134813783 |
| Molecular Formula | C13H24O4Si |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | [(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienyl] methyl carbonate |
| SMILES | C=C(/C=C/COC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H24O4Si/c1-11(9-8-10-16-12(14)15-5)17-18(6,7)13(2,3)4/h8-9H,1,10H2,2-7H3/b9-8+ |
| InChIKey | BONPEYSABZSVEX-CMDGGOBGSA-N |
| XLogP | 3.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|