C11H11N3O2 — CID 175779543
4-methyl-2-(2-methyl-4-pyridinyl)-1,3-oxazole-5-carboxamide (PubChem CID 175779543) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 4-methyl-2-(2-methyl-4-pyridinyl)-1,3-oxazole-5-carboxamide.
| Compound Name | 4-methyl-2-(2-methyl-4-pyridinyl)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 175779543 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 4-methyl-2-(2-methyl-4-pyridinyl)-1,3-oxazole-5-carboxamide |
| SMILES | Cc1cc(-c2nc(C)c(C(N)=O)o2)ccn1 |
| InChI | InChI=1S/C11H11N3O2/c1-6-5-8(3-4-13-6)11-14-7(2)9(16-11)10(12)15/h3-5H,1-2H3,(H2,12,15) |
| InChIKey | PUYKDZBXLUESAB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |