4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid

C14H10N2O3 — CID 175214662

IUPAC4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid
SMILESCc1ccc2oc(-c3ccnc(C(=O)O)c3)nc2c1
InChIInChI=1S/C14H10N2O3/c1-8-2-3-12-10(6-8)16-13(19-12)9-4-5-15-11(7-9)14(17)18/h2-7H,1H3,(H,17,18)
InChIKeyGPDBHTIPTWFAMM-UHFFFAOYSA-N
MW254.25 g/mol
LogP2.90
Rot. Bonds2

About 4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid

4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid (PubChem CID 175214662) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid
PubChem CID175214662
Molecular FormulaC14H10N2O3
Molecular Weight254.25 g/mol
Exact Mass254.07
IUPAC Name4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid
SMILESCc1ccc2oc(-c3ccnc(C(=O)O)c3)nc2c1
InChIInChI=1S/C14H10N2O3/c1-8-2-3-12-10(6-8)16-13(19-12)9-4-5-15-11(7-9)14(17)18/h2-7H,1H3,(H,17,18)
InChIKeyGPDBHTIPTWFAMM-UHFFFAOYSA-N
XLogP2.90
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.25
LogP ≤ 52.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid?
The IUPAC name of 4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid (CID 175214662) is 4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid.
What is the SMILES notation for 4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid?
The canonical SMILES for 4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid is Cc1ccc2oc(-c3ccnc(C(=O)O)c3)nc2c1.
What is the InChIKey of 4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid?
The InChIKey is GPDBHTIPTWFAMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O3/c1-8-2-3-12-10(6-8)16-13(19-12)9-4-5-15-11(7-9)14(17)18/h2-7H,1H3,(H,17,18).
What are the key properties of 4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid?
4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid has a molecular weight of 254.25 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-1,3-benzoxazol-2-yl)pyridine-2-carboxylic acid is sourced from PubChem (CID 175214662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).