C16H12F3NO5S2 — CID 175780409
[4-[(4-methoxyphenyl)methyl]-5-oxothieno[3,2-b]pyridin-7-yl] trifluoromethanesulfonate (PubChem CID 175780409) has the molecular formula C16H12F3NO5S2 and a molecular weight of 419.40 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)methyl]-5-oxothieno[3,2-b]pyridin-7-yl] trifluoromethanesulfonate.
| Compound Name | [4-[(4-methoxyphenyl)methyl]-5-oxothieno[3,2-b]pyridin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175780409 |
| Molecular Formula | C16H12F3NO5S2 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | [4-[(4-methoxyphenyl)methyl]-5-oxothieno[3,2-b]pyridin-7-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(Cn2c(=O)cc(OS(=O)(=O)C(F)(F)F)c3sccc32)cc1 |
| InChI | InChI=1S/C16H12F3NO5S2/c1-24-11-4-2-10(3-5-11)9-20-12-6-7-26-15(12)13(8-14(20)21)25-27(22,23)16(17,18)19/h2-8H,9H2,1H3 |
| InChIKey | AGXXXCGISLMCQP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|