C9H6F3N3O2 — CID 175783048
1-[5-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione (PubChem CID 175783048) has the molecular formula C9H6F3N3O2 and a molecular weight of 245.16 g/mol. Its IUPAC name is 1-[5-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 175783048 |
| Molecular Formula | C9H6F3N3O2 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 1-[5-(trifluoromethyl)-3-pyridinyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(c2cncc(C(F)(F)F)c2)C(=O)N1 |
| InChI | InChI=1S/C9H6F3N3O2/c10-9(11,12)5-1-6(3-13-2-5)15-4-7(16)14-8(15)17/h1-3H,4H2,(H,14,16,17) |
| InChIKey | QFOKETDXPPJYLV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|