C14H13BrN5OP — CID 175784370
N-(5-bromo-2-deuteriopyrimidin-4-yl)-5-dimethylphosphorylquinoxalin-6-amine (PubChem CID 175784370) has the molecular formula C14H13BrN5OP and a molecular weight of 379.18 g/mol. Its IUPAC name is N-(5-bromo-2-deuteriopyrimidin-4-yl)-5-dimethylphosphorylquinoxalin-6-amine.
| Compound Name | N-(5-bromo-2-deuteriopyrimidin-4-yl)-5-dimethylphosphorylquinoxalin-6-amine |
|---|---|
| PubChem CID | 175784370 |
| Molecular Formula | C14H13BrN5OP |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | N-(5-bromo-2-deuteriopyrimidin-4-yl)-5-dimethylphosphorylquinoxalin-6-amine |
| SMILES | [2H]c1ncc(Br)c(Nc2ccc3nccnc3c2P(C)(C)=O)n1 |
| InChI | InChI=1S/C14H13BrN5OP/c1-22(2,21)13-11(20-14-9(15)7-16-8-19-14)4-3-10-12(13)18-6-5-17-10/h3-8H,1-2H3,(H,16,19,20)/i8D |
| InChIKey | LQBHMZAIKJLQLB-BNEYPBHNSA-N |
| XLogP | 3.17 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|