C34H34N6O6 — CID 175784810
2-N,2-N-bis[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]naphthalene-2,7-diamine (PubChem CID 175784810) has the molecular formula C34H34N6O6 and a molecular weight of 622.68 g/mol. Its IUPAC name is 2-N,2-N-bis[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]naphthalene-2,7-diamine.
| Compound Name | 2-N,2-N-bis[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]naphthalene-2,7-diamine |
|---|---|
| PubChem CID | 175784810 |
| Molecular Formula | C34H34N6O6 |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | 2-N,2-N-bis[1-(3,4,5-trimethoxyphenyl)imidazol-4-yl]naphthalene-2,7-diamine |
| SMILES | COc1cc(-n2cnc(N(c3ccc4ccc(N)cc4c3)c3cn(-c4cc(OC)c(OC)c(OC)c4)cn3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C34H34N6O6/c1-41-27-13-25(14-28(42-2)33(27)45-5)38-17-31(36-19-38)40(24-10-8-21-7-9-23(35)11-22(21)12-24)32-18-39(20-37-32)26-15-29(43-3)34(46-6)30(16-26)44-4/h7-20H,35H2,1-6H3 |
| InChIKey | LDMQEHULYBMGFT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|