C21H20F3NO4 — CID 175785765
(2S)-4-methyl-2-[[2,2,2-trifluoro-1-(8-formyldibenzofuran-3-yl)ethyl]amino]pentanoic acid (PubChem CID 175785765) has the molecular formula C21H20F3NO4 and a molecular weight of 407.39 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[2,2,2-trifluoro-1-(8-formyldibenzofuran-3-yl)ethyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[2,2,2-trifluoro-1-(8-formyldibenzofuran-3-yl)ethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 175785765 |
| Molecular Formula | C21H20F3NO4 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (2S)-4-methyl-2-[[2,2,2-trifluoro-1-(8-formyldibenzofuran-3-yl)ethyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(c1ccc2c(c1)oc1ccc(C=O)cc12)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C21H20F3NO4/c1-11(2)7-16(20(27)28)25-19(21(22,23)24)13-4-5-14-15-8-12(10-26)3-6-17(15)29-18(14)9-13/h3-6,8-11,16,19,25H,7H2,1-2H3,(H,27,28)/t16-,19?/m0/s1 |
| InChIKey | NLHQPGKMBLGYLZ-UCFFOFKASA-N |
| XLogP | 5.09 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|