C11H17F3OS — CID 175786674
3-(cyclohexylsulfanylmethyl)-4,4,4-trifluorobutanal (PubChem CID 175786674) has the molecular formula C11H17F3OS and a molecular weight of 254.32 g/mol. Its IUPAC name is 3-(cyclohexylsulfanylmethyl)-4,4,4-trifluorobutanal.
| Compound Name | 3-(cyclohexylsulfanylmethyl)-4,4,4-trifluorobutanal |
|---|---|
| PubChem CID | 175786674 |
| Molecular Formula | C11H17F3OS |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 3-(cyclohexylsulfanylmethyl)-4,4,4-trifluorobutanal |
| SMILES | O=CCC(CSC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H17F3OS/c12-11(13,14)9(6-7-15)8-16-10-4-2-1-3-5-10/h7,9-10H,1-6,8H2 |
| InChIKey | MXTXXIDBGOMJLX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|