C19H36N6O6 — CID 175787528
(2S)-5-(diaminomethylideneamino)-2-[[2-[[(2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetyl]amino]pentanoic acid (PubChem CID 175787528) has the molecular formula C19H36N6O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 175787528 |
| Molecular Formula | C19H36N6O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]acetyl]amino]pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H36N6O6/c1-6-11(2)14(25-18(30)31-19(3,4)5)15(27)23-10-13(26)24-12(16(28)29)8-7-9-22-17(20)21/h11-12,14H,6-10H2,1-5H3,(H,23,27)(H,24,26)(H,25,30)(H,28,29)(H4,20,21,22)/t11-,12-,14-/m0/s1 |
| InChIKey | ZKSQVNUADAWHMU-OBJOEFQTSA-N |
| XLogP | -0.34 |
| TPSA | 198.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|