C19H15ClFN3O3S — CID 175791411
2-[4-[2-(6-chloro-3-pyridinyl)-3-sulfamoylphenyl]-2-fluorophenyl]acetamide (PubChem CID 175791411) has the molecular formula C19H15ClFN3O3S and a molecular weight of 419.87 g/mol. Its IUPAC name is 2-[4-[2-(6-chloro-3-pyridinyl)-3-sulfamoylphenyl]-2-fluorophenyl]acetamide.
| Compound Name | 2-[4-[2-(6-chloro-3-pyridinyl)-3-sulfamoylphenyl]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 175791411 |
| Molecular Formula | C19H15ClFN3O3S |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 2-[4-[2-(6-chloro-3-pyridinyl)-3-sulfamoylphenyl]-2-fluorophenyl]acetamide |
| SMILES | NC(=O)Cc1ccc(-c2cccc(S(N)(=O)=O)c2-c2ccc(Cl)nc2)cc1F |
| InChI | InChI=1S/C19H15ClFN3O3S/c20-17-7-6-13(10-24-17)19-14(2-1-3-16(19)28(23,26)27)11-4-5-12(9-18(22)25)15(21)8-11/h1-8,10H,9H2,(H2,22,25)(H2,23,26,27) |
| InChIKey | IUYACJXZPWJBDP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|