C8H9ClN2O3S — CID 169224386
2-(2-chloro-3-sulfamoylphenyl)acetamide (PubChem CID 169224386) has the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. Its IUPAC name is 2-(2-chloro-3-sulfamoylphenyl)acetamide.
| Compound Name | 2-(2-chloro-3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 169224386 |
| Molecular Formula | C8H9ClN2O3S |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-(2-chloro-3-sulfamoylphenyl)acetamide |
| SMILES | NC(=O)Cc1cccc(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C8H9ClN2O3S/c9-8-5(4-7(10)12)2-1-3-6(8)15(11,13)14/h1-3H,4H2,(H2,10,12)(H2,11,13,14) |
| InChIKey | OBYYNXOPEPINHT-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |