C19H18N4O2 — CID 175791904
4-[3-(4-aminophenyl)imidazo[1,2-a]pyridin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 175791904) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-[3-(4-aminophenyl)imidazo[1,2-a]pyridin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 4-[3-(4-aminophenyl)imidazo[1,2-a]pyridin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 175791904 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[3-(4-aminophenyl)imidazo[1,2-a]pyridin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | Nc1ccc(-c2cnc3cc(C4=CCN(C(=O)O)CC4)ccn23)cc1 |
| InChI | InChI=1S/C19H18N4O2/c20-16-3-1-14(2-4-16)17-12-21-18-11-15(7-10-23(17)18)13-5-8-22(9-6-13)19(24)25/h1-5,7,10-12H,6,8-9,20H2,(H,24,25) |
| InChIKey | NFBGWNUBFRBFHD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|