C19H20N2O2 — CID 90182373
benzyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 90182373) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is benzyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 90182373 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | benzyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | Nc1ccc(C2=CCN(C(=O)OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H20N2O2/c20-18-8-6-16(7-9-18)17-10-12-21(13-11-17)19(22)23-14-15-4-2-1-3-5-15/h1-10H,11-14,20H2 |
| InChIKey | MWOWNZLPNOHURR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|