C18H16ClNO2 — CID 11507904
benzyl 3-(4-chlorophenyl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 11507904) has the molecular formula C18H16ClNO2 and a molecular weight of 313.78 g/mol. Its IUPAC name is benzyl 3-(4-chlorophenyl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | benzyl 3-(4-chlorophenyl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 11507904 |
| Molecular Formula | C18H16ClNO2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | benzyl 3-(4-chlorophenyl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC=C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H16ClNO2/c19-17-8-6-15(7-9-17)16-10-11-20(12-16)18(21)22-13-14-4-2-1-3-5-14/h1-10H,11-13H2 |
| InChIKey | BXWIVAKFYCSJGZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |