About butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate
butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 153154771) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| PubChem CID | 153154771 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC=C(c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C16H22N2O2/c1-2-3-12-20-16(19)18-10-8-14(9-11-18)13-4-6-15(17)7-5-13/h4-8H,2-3,9-12,17H2,1H3 |
| InChIKey | WBEDMRZEWRJGIW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (CID 153154771) is butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate is CCCCOC(=O)N1CC=C(c2ccc(N)cc2)CC1.
What is the InChIKey of butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is WBEDMRZEWRJGIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-2-3-12-20-16(19)18-10-8-14(9-11-18)13-4-6-15(17)7-5-13/h4-8H,2-3,9-12,17H2,1H3.
What are the key properties of butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate?
butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 274.36 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-(4-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 153154771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).