C17H19ClN2O2S — CID 67566610
butyl 4-(6-chloro-1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 67566610) has the molecular formula C17H19ClN2O2S and a molecular weight of 350.87 g/mol. Its IUPAC name is butyl 4-(6-chloro-1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | butyl 4-(6-chloro-1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 67566610 |
| Molecular Formula | C17H19ClN2O2S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | butyl 4-(6-chloro-1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC=C(c2nc3ccc(Cl)cc3s2)CC1 |
| InChI | InChI=1S/C17H19ClN2O2S/c1-2-3-10-22-17(21)20-8-6-12(7-9-20)16-19-14-5-4-13(18)11-15(14)23-16/h4-6,11H,2-3,7-10H2,1H3 |
| InChIKey | HYKGVKKDZRZJJM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|