C24H27N5O3 — CID 159334664
butyl 4-[4-(imidazo[1,2-a]pyridin-6-ylcarbamoylamino)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 159334664) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is butyl 4-[4-(imidazo[1,2-a]pyridin-6-ylcarbamoylamino)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | butyl 4-[4-(imidazo[1,2-a]pyridin-6-ylcarbamoylamino)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 159334664 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | butyl 4-[4-(imidazo[1,2-a]pyridin-6-ylcarbamoylamino)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC=C(c2ccc(NC(=O)Nc3ccc4nccn4c3)cc2)CC1 |
| InChI | InChI=1S/C24H27N5O3/c1-2-3-16-32-24(31)28-13-10-19(11-14-28)18-4-6-20(7-5-18)26-23(30)27-21-8-9-22-25-12-15-29(22)17-21/h4-10,12,15,17H,2-3,11,13-14,16H2,1H3,(H2,26,27,30) |
| InChIKey | LFJLRPXCPUWPEA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|