About methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid
methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid (PubChem CID 175791959) has the molecular formula C11H18F3NO4
and a molecular weight of 285.26 g/mol. Its IUPAC name is methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid |
| PubChem CID | 175791959 |
| Molecular Formula | C11H18F3NO4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)C(C)(C)[C@@H]1CCNC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H17NO2.C2HF3O2/c1-9(2,8(11)12-3)7-4-5-10-6-7;3-2(4,5)1(6)7/h7,10H,4-6H2,1-3H3;(H,6,7)/t7-;/m1./s1 |
| InChIKey | UOKXUAVGBJDPIX-OGFXRTJISA-N |
| XLogP | 1.43 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid?
The IUPAC name of methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid (CID 175791959) is methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid?
The canonical SMILES for methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid is COC(=O)C(C)(C)[C@@H]1CCNC1.O=C(O)C(F)(F)F.
What is the InChIKey of methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid?
The InChIKey is UOKXUAVGBJDPIX-OGFXRTJISA-N. The full InChI is InChI=1S/C9H17NO2.C2HF3O2/c1-9(2,8(11)12-3)7-4-5-10-6-7;3-2(4,5)1(6)7/h7,10H,4-6H2,1-3H3;(H,6,7)/t7-;/m1./s1.
What are the key properties of methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid?
methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid has a molecular weight of 285.26 g/mol, XLogP of 1.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-2-[(3S)-pyrrolidin-3-yl]propanoate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 175791959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).