C14H19NO2 — CID 175792465
5-deuterio-4-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpyridine (PubChem CID 175792465) has the molecular formula C14H19NO2 and a molecular weight of 234.32 g/mol. Its IUPAC name is 5-deuterio-4-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpyridine.
| Compound Name | 5-deuterio-4-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpyridine |
|---|---|
| PubChem CID | 175792465 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 5-deuterio-4-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpyridine |
| SMILES | [2H]c1cnc(C)cc1C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H19NO2/c1-11-10-13(4-7-15-11)12-2-5-14(6-3-12)16-8-9-17-14/h4,7,10,12H,2-3,5-6,8-9H2,1H3/i4D |
| InChIKey | BKRJZQKKIWDTEF-QYKNYGDISA-N |
| XLogP | 2.79 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |