C21H30N2O6 — CID 175795715
butanoic acid;tert-butyl 2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]acetate (PubChem CID 175795715) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is butanoic acid;tert-butyl 2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]acetate.
| Compound Name | butanoic acid;tert-butyl 2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]acetate |
|---|---|
| PubChem CID | 175795715 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | butanoic acid;tert-butyl 2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]acetate |
| SMILES | CC(C)(C)OC(=O)C(=O)Nc1ccc(N2CCCCC2=O)cc1.CCCC(=O)O |
| InChI | InChI=1S/C17H22N2O4.C4H8O2/c1-17(2,3)23-16(22)15(21)18-12-7-9-13(10-8-12)19-11-5-4-6-14(19)20;1-2-3-4(5)6/h7-10H,4-6,11H2,1-3H3,(H,18,21);2-3H2,1H3,(H,5,6) |
| InChIKey | UAEXNRKUMXCZGD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|