C16H23N2O5P — CID 87236403
3-dimethoxyphosphoryl-N-[4-(2-oxopiperidin-1-yl)phenyl]propanamide (PubChem CID 87236403) has the molecular formula C16H23N2O5P and a molecular weight of 354.34 g/mol. Its IUPAC name is 3-dimethoxyphosphoryl-N-[4-(2-oxopiperidin-1-yl)phenyl]propanamide.
| Compound Name | 3-dimethoxyphosphoryl-N-[4-(2-oxopiperidin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 87236403 |
| Molecular Formula | C16H23N2O5P |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 3-dimethoxyphosphoryl-N-[4-(2-oxopiperidin-1-yl)phenyl]propanamide |
| SMILES | COP(=O)(CCC(=O)Nc1ccc(N2CCCCC2=O)cc1)OC |
| InChI | InChI=1S/C16H23N2O5P/c1-22-24(21,23-2)12-10-15(19)17-13-6-8-14(9-7-13)18-11-4-3-5-16(18)20/h6-9H,3-5,10-12H2,1-2H3,(H,17,19) |
| InChIKey | CPBXGRXGORJAQG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|