C18H23N3O2S2 — CID 8694503
[3-oxo-3-[4-(2-oxopyrrolidin-1-yl)anilino]propyl] pyrrolidine-1-carbodithioate (PubChem CID 8694503) has the molecular formula C18H23N3O2S2 and a molecular weight of 377.54 g/mol. Its IUPAC name is [3-oxo-3-[4-(2-oxopyrrolidin-1-yl)anilino]propyl] pyrrolidine-1-carbodithioate.
| Compound Name | [3-oxo-3-[4-(2-oxopyrrolidin-1-yl)anilino]propyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 8694503 |
| Molecular Formula | C18H23N3O2S2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | [3-oxo-3-[4-(2-oxopyrrolidin-1-yl)anilino]propyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CCSC(=S)N1CCCC1)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H23N3O2S2/c22-16(9-13-25-18(24)20-10-1-2-11-20)19-14-5-7-15(8-6-14)21-12-3-4-17(21)23/h5-8H,1-4,9-13H2,(H,19,22) |
| InChIKey | RFAQJWCKFZHVNU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|