About lithium trioxepane-4-carboxylate
lithium trioxepane-4-carboxylate (PubChem CID 175798108) has the molecular formula C5H7LiO5
and a molecular weight of 154.05 g/mol. Its IUPAC name is lithium trioxepane-4-carboxylate.
Molecular Properties
| Compound Name | lithium trioxepane-4-carboxylate |
| PubChem CID | 175798108 |
| Molecular Formula | C5H7LiO5 |
| Molecular Weight | 154.05 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | lithium trioxepane-4-carboxylate |
| SMILES | O=C([O-])C1CCCOOO1.[Li+] |
| InChI | InChI=1S/C5H8O5.Li/c6-5(7)4-2-1-3-8-10-9-4;/h4H,1-3H2,(H,6,7);/q;+1/p-1 |
| InChIKey | XBGMNCFOHSNLTK-UHFFFAOYSA-M |
| XLogP | -4.22 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.05 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze lithium trioxepane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium trioxepane-4-carboxylate?
The IUPAC name of lithium trioxepane-4-carboxylate (CID 175798108) is lithium trioxepane-4-carboxylate.
What is the SMILES notation for lithium trioxepane-4-carboxylate?
The canonical SMILES for lithium trioxepane-4-carboxylate is O=C([O-])C1CCCOOO1.[Li+].
What is the InChIKey of lithium trioxepane-4-carboxylate?
The InChIKey is XBGMNCFOHSNLTK-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O5.Li/c6-5(7)4-2-1-3-8-10-9-4;/h4H,1-3H2,(H,6,7);/q;+1/p-1.
What are the key properties of lithium trioxepane-4-carboxylate?
lithium trioxepane-4-carboxylate has a molecular weight of 154.05 g/mol, XLogP of -4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium trioxepane-4-carboxylate is sourced from PubChem (CID 175798108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).