About trioxepane-4-carboxylic acid
trioxepane-4-carboxylic acid (PubChem CID 174899438) has the molecular formula C5H8O5
and a molecular weight of 148.11 g/mol. Its IUPAC name is trioxepane-4-carboxylic acid.
Molecular Properties
| Compound Name | trioxepane-4-carboxylic acid |
| PubChem CID | 174899438 |
| Molecular Formula | C5H8O5 |
| Molecular Weight | 148.11 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | trioxepane-4-carboxylic acid |
| SMILES | O=C(O)C1CCCOOO1 |
| InChI | InChI=1S/C5H8O5/c6-5(7)4-2-1-3-8-10-9-4/h4H,1-3H2,(H,6,7) |
| InChIKey | ZREXZTQZBYESJH-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.11 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze trioxepane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trioxepane-4-carboxylic acid?
The IUPAC name of trioxepane-4-carboxylic acid (CID 174899438) is trioxepane-4-carboxylic acid.
What is the SMILES notation for trioxepane-4-carboxylic acid?
The canonical SMILES for trioxepane-4-carboxylic acid is O=C(O)C1CCCOOO1.
What is the InChIKey of trioxepane-4-carboxylic acid?
The InChIKey is ZREXZTQZBYESJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O5/c6-5(7)4-2-1-3-8-10-9-4/h4H,1-3H2,(H,6,7).
What are the key properties of trioxepane-4-carboxylic acid?
trioxepane-4-carboxylic acid has a molecular weight of 148.11 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trioxepane-4-carboxylic acid is sourced from PubChem (CID 174899438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).