trioxepane-4-carboxylic acid

C5H8O5 — CID 174899438

IUPACtrioxepane-4-carboxylic acid
SMILESO=C(O)C1CCCOOO1
InChIInChI=1S/C5H8O5/c6-5(7)4-2-1-3-8-10-9-4/h4H,1-3H2,(H,6,7)
InChIKeyZREXZTQZBYESJH-UHFFFAOYSA-N
MW148.11 g/mol
LogP0.11
Rot. Bonds1

About trioxepane-4-carboxylic acid

trioxepane-4-carboxylic acid (PubChem CID 174899438) has the molecular formula C5H8O5 and a molecular weight of 148.11 g/mol. Its IUPAC name is trioxepane-4-carboxylic acid.

Molecular Properties

Compound Nametrioxepane-4-carboxylic acid
PubChem CID174899438
Molecular FormulaC5H8O5
Molecular Weight148.11 g/mol
Exact Mass148.04
IUPAC Nametrioxepane-4-carboxylic acid
SMILESO=C(O)C1CCCOOO1
InChIInChI=1S/C5H8O5/c6-5(7)4-2-1-3-8-10-9-4/h4H,1-3H2,(H,6,7)
InChIKeyZREXZTQZBYESJH-UHFFFAOYSA-N
XLogP0.11
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.11
LogP ≤ 50.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze trioxepane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trioxepane-4-carboxylic acid?
The IUPAC name of trioxepane-4-carboxylic acid (CID 174899438) is trioxepane-4-carboxylic acid.
What is the SMILES notation for trioxepane-4-carboxylic acid?
The canonical SMILES for trioxepane-4-carboxylic acid is O=C(O)C1CCCOOO1.
What is the InChIKey of trioxepane-4-carboxylic acid?
The InChIKey is ZREXZTQZBYESJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O5/c6-5(7)4-2-1-3-8-10-9-4/h4H,1-3H2,(H,6,7).
What are the key properties of trioxepane-4-carboxylic acid?
trioxepane-4-carboxylic acid has a molecular weight of 148.11 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trioxepane-4-carboxylic acid is sourced from PubChem (CID 174899438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).