C22H24F2N2O3 — CID 175798153
4-[(3,5-difluorophenyl)methyl]-3-(dimethoxymethyl)-1-(oxan-2-yl)indazole (PubChem CID 175798153) has the molecular formula C22H24F2N2O3 and a molecular weight of 402.44 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methyl]-3-(dimethoxymethyl)-1-(oxan-2-yl)indazole.
| Compound Name | 4-[(3,5-difluorophenyl)methyl]-3-(dimethoxymethyl)-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 175798153 |
| Molecular Formula | C22H24F2N2O3 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methyl]-3-(dimethoxymethyl)-1-(oxan-2-yl)indazole |
| SMILES | COC(OC)c1nn(C2CCCCO2)c2cccc(Cc3cc(F)cc(F)c3)c12 |
| InChI | InChI=1S/C22H24F2N2O3/c1-27-22(28-2)21-20-15(10-14-11-16(23)13-17(24)12-14)6-5-7-18(20)26(25-21)19-8-3-4-9-29-19/h5-7,11-13,19,22H,3-4,8-10H2,1-2H3 |
| InChIKey | ZVCJTVIWQGEALS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|