About [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+)
[2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+) (PubChem CID 175798666) has the molecular formula C25H19Cl2PPd+2
and a molecular weight of 527.73 g/mol. Its IUPAC name is [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+).
Molecular Properties
| Compound Name | [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+) |
| PubChem CID | 175798666 |
| Molecular Formula | C25H19Cl2PPd+2 |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 525.96 |
| IUPAC Name | [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+) |
| SMILES | ClC(Cl)(c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1.[Pd+2] |
| InChI | InChI=1S/C25H19Cl2P.Pd/c26-25(27,20-12-4-1-5-13-20)23-18-10-11-19-24(23)28(21-14-6-2-7-15-21)22-16-8-3-9-17-22;/h1-19H;/q;+2 |
| InChIKey | CUWDETMLIRVDHT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+)?
The IUPAC name of [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+) (CID 175798666) is [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+).
What is the SMILES notation for [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+)?
The canonical SMILES for [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+) is ClC(Cl)(c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1.[Pd+2].
What is the InChIKey of [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+)?
The InChIKey is CUWDETMLIRVDHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19Cl2P.Pd/c26-25(27,20-12-4-1-5-13-20)23-18-10-11-19-24(23)28(21-14-6-2-7-15-21)22-16-8-3-9-17-22;/h1-19H;/q;+2.
What are the key properties of [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+)?
[2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+) has a molecular weight of 527.73 g/mol, XLogP of 6.12, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[dichloro(phenyl)methyl]phenyl]-diphenylphosphane;palladium(2+) is sourced from PubChem (CID 175798666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).