C18H24N2O2 — CID 175802407
2-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2-oxo-N-piperidin-1-ylacetamide (PubChem CID 175802407) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2-oxo-N-piperidin-1-ylacetamide.
| Compound Name | 2-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2-oxo-N-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 175802407 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)-2-oxo-N-piperidin-1-ylacetamide |
| SMILES | Cc1c(C(=O)C(=O)NN2CCCCC2)ccc2c1CCCC2 |
| InChI | InChI=1S/C18H24N2O2/c1-13-15-8-4-3-7-14(15)9-10-16(13)17(21)18(22)19-20-11-5-2-6-12-20/h9-10H,2-8,11-12H2,1H3,(H,19,22) |
| InChIKey | LTMQALWRHHQWKC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|