C14H20N4 — CID 174267752
2-[(Z)-1-amino-1-(4-methyl-2,3-dihydro-1H-inden-5-yl)prop-1-en-2-yl]guanidine (PubChem CID 174267752) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-[(Z)-1-amino-1-(4-methyl-2,3-dihydro-1H-inden-5-yl)prop-1-en-2-yl]guanidine.
| Compound Name | 2-[(Z)-1-amino-1-(4-methyl-2,3-dihydro-1H-inden-5-yl)prop-1-en-2-yl]guanidine |
|---|---|
| PubChem CID | 174267752 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 2-[(Z)-1-amino-1-(4-methyl-2,3-dihydro-1H-inden-5-yl)prop-1-en-2-yl]guanidine |
| SMILES | C/C(N=C(N)N)=C(/N)c1ccc2c(c1C)CCC2 |
| InChI | InChI=1S/C14H20N4/c1-8-11-5-3-4-10(11)6-7-12(8)13(15)9(2)18-14(16)17/h6-7H,3-5,15H2,1-2H3,(H4,16,17,18)/b13-9- |
| InChIKey | KJLNELJXHNYPRH-LCYFTJDESA-N |
| XLogP | 1.40 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|