C14H18 — CID 156857499
5-cyclobutyl-4-methyl-2,3-dihydro-1H-indene (PubChem CID 156857499) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 5-cyclobutyl-4-methyl-2,3-dihydro-1H-indene.
| Compound Name | 5-cyclobutyl-4-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 156857499 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 5-cyclobutyl-4-methyl-2,3-dihydro-1H-indene |
| SMILES | Cc1c(C2CCC2)ccc2c1CCC2 |
| InChI | InChI=1S/C14H18/c1-10-13-7-3-6-12(13)8-9-14(10)11-4-2-5-11/h8-9,11H,2-7H2,1H3 |
| InChIKey | BPBJJJCZGZQMGM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |