C15H18O — CID 129225186
10-methyl-1,2,3,6,7,8-hexahydrocyclohepta[e]inden-6-ol (PubChem CID 129225186) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 10-methyl-1,2,3,6,7,8-hexahydrocyclohepta[e]inden-6-ol.
| Compound Name | 10-methyl-1,2,3,6,7,8-hexahydrocyclohepta[e]inden-6-ol |
|---|---|
| PubChem CID | 129225186 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 10-methyl-1,2,3,6,7,8-hexahydrocyclohepta[e]inden-6-ol |
| SMILES | CC1=CCCC(O)c2ccc3c(c21)CCC3 |
| InChI | InChI=1S/C15H18O/c1-10-4-2-7-14(16)13-9-8-11-5-3-6-12(11)15(10)13/h4,8-9,14,16H,2-3,5-7H2,1H3 |
| InChIKey | ORSPJKNODIXIII-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |