C13H16N2O2 — CID 155661871
bicyclo[5.3.1]undeca-1(11),7,9-triene-8,11-dicarboxamide (PubChem CID 155661871) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is bicyclo[5.3.1]undeca-1(11),7,9-triene-8,11-dicarboxamide.
| Compound Name | bicyclo[5.3.1]undeca-1(11),7,9-triene-8,11-dicarboxamide |
|---|---|
| PubChem CID | 155661871 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | bicyclo[5.3.1]undeca-1(11),7,9-triene-8,11-dicarboxamide |
| SMILES | NC(=O)c1ccc2c(C(N)=O)c1CCCCC2 |
| InChI | InChI=1S/C13H16N2O2/c14-12(16)10-7-6-8-4-2-1-3-5-9(10)11(8)13(15)17/h6-7H,1-5H2,(H2,14,16)(H2,15,17) |
| InChIKey | YVFOZFVJTZDMPB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |